C10H13BrN2S — CID 106482041
5-bromo-6-cyclopentyl-2-methyl-1H-pyrimidine-4-thione (PubChem CID 106482041) has the molecular formula C10H13BrN2S and a molecular weight of 273.20 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-methyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482041 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-methyl-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c(Br)c(C2CCCC2)[nH]1 |
| InChI | InChI=1S/C10H13BrN2S/c1-6-12-9(7-4-2-3-5-7)8(11)10(14)13-6/h7H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | YJKUDZSXGCOUCS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|