C11H17N3OS — CID 106482498
2-[2-(dimethylamino)ethyl]-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione (PubChem CID 106482498) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione.
| Compound Name | 2-[2-(dimethylamino)ethyl]-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482498 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione |
| SMILES | CN(C)CCc1nc(=S)c2c([nH]1)CCOC2 |
| InChI | InChI=1S/C11H17N3OS/c1-14(2)5-3-10-12-9-4-6-15-7-8(9)11(16)13-10/h3-7H2,1-2H3,(H,12,13,16) |
| InChIKey | ZAQXZJQXFLRZHF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|