C26H40O6Si — CID 10648274
(1S,5S,6S,12S,16S)-16-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-7-methoxy-15,18,18-trimethyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-7,10,14-trien-3-one (PubChem CID 10648274) has the molecular formula C26H40O6Si and a molecular weight of 476.69 g/mol. Its IUPAC name is (1S,5S,6S,12S,16S)-16-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-7-methoxy-15,18,18-trimethyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-7,10,14-trien-3-one.
| Compound Name | (1S,5S,6S,12S,16S)-16-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-7-methoxy-15,18,18-trimethyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-7,10,14-trien-3-one |
|---|---|
| PubChem CID | 10648274 |
| Molecular Formula | C26H40O6Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (1S,5S,6S,12S,16S)-16-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-7-methoxy-15,18,18-trimethyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-7,10,14-trien-3-one |
| SMILES | COC1=CCC=C2[C@H]1[C@@H]1OC(=O)O[C@]13C[C@H](O[Si](C)(C)C(C)(C)C)C(C)=C(C[C@@H]2O)C3(C)C |
| InChI | InChI=1S/C26H40O6Si/c1-15-17-13-18(27)16-11-10-12-19(29-7)21(16)22-26(25(17,5)6,31-23(28)30-22)14-20(15)32-33(8,9)24(2,3)4/h11-12,18,20-22,27H,10,13-14H2,1-9H3/t18-,20-,21+,22-,26+/m0/s1 |
| InChIKey | SPQLOBXVIBJGSS-YAZAZGCCSA-N |
| XLogP | 5.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|