C30H52O4 — CID 10648275
(1S,2R,4R,5S,7R,11S,12S,15R,16S)-15-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-2,16-dimethyl-8-methylidenetetracyclo[9.7.0.02,7.012,16]octadecane-4,5-diol (PubChem CID 10648275) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is (1S,2R,4R,5S,7R,11S,12S,15R,16S)-15-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-2,16-dimethyl-8-methylidenetetracyclo[9.7.0.02,7.012,16]octadecane-4,5-diol.
| Compound Name | (1S,2R,4R,5S,7R,11S,12S,15R,16S)-15-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-2,16-dimethyl-8-methylidenetetracyclo[9.7.0.02,7.012,16]octadecane-4,5-diol |
|---|---|
| PubChem CID | 10648275 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | (1S,2R,4R,5S,7R,11S,12S,15R,16S)-15-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-2,16-dimethyl-8-methylidenetetracyclo[9.7.0.02,7.012,16]octadecane-4,5-diol |
| SMILES | C=C1CC[C@@H]2[C@H](CC[C@]3(C)[C@@H]([C@H](C)[C@@H](O)[C@H](O)[C@@H](C)C(C)C)CC[C@@H]23)[C@@]2(C)C[C@@H](O)[C@@H](O)C[C@H]12 |
| InChI | InChI=1S/C30H52O4/c1-16(2)18(4)27(33)28(34)19(5)21-10-11-22-20-9-8-17(3)24-14-25(31)26(32)15-30(24,7)23(20)12-13-29(21,22)6/h16,18-28,31-34H,3,8-15H2,1-2,4-7H3/t18-,19-,20-,21+,22-,23-,24+,25-,26+,27+,28+,29+,30+/m0/s1 |
| InChIKey | RCAFYAHHAOKAKX-UJLXKNQBSA-N |
| XLogP | 5.18 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|