C12H11ClN4S — CID 106482764
2-(3-chloro-2-pyridinyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione (PubChem CID 106482764) has the molecular formula C12H11ClN4S and a molecular weight of 278.77 g/mol. Its IUPAC name is 2-(3-chloro-2-pyridinyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione.
| Compound Name | 2-(3-chloro-2-pyridinyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482764 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(3-chloro-2-pyridinyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
| SMILES | S=c1nc(-c2ncccc2Cl)[nH]c2c1CNCC2 |
| InChI | InChI=1S/C12H11ClN4S/c13-8-2-1-4-15-10(8)11-16-9-3-5-14-6-7(9)12(18)17-11/h1-2,4,14H,3,5-6H2,(H,16,17,18) |
| InChIKey | RPFSSOMBVMGQPR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|