C17H21NO2S — CID 106483976
benzyl 2-methyl-3-(2-thiophen-3-ylethylamino)propanoate (PubChem CID 106483976) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is benzyl 2-methyl-3-(2-thiophen-3-ylethylamino)propanoate.
| Compound Name | benzyl 2-methyl-3-(2-thiophen-3-ylethylamino)propanoate |
|---|---|
| PubChem CID | 106483976 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | benzyl 2-methyl-3-(2-thiophen-3-ylethylamino)propanoate |
| SMILES | CC(CNCCc1ccsc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO2S/c1-14(11-18-9-7-16-8-10-21-13-16)17(19)20-12-15-5-3-2-4-6-15/h2-6,8,10,13-14,18H,7,9,11-12H2,1H3 |
| InChIKey | MOJRCHGOBAOUCM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|