C24H32O6S2 — CID 10648416
[(1R,2R)-2-[(2,4,6-trimethylphenyl)sulfonyloxymethyl]cyclobutyl]methyl 2,4,6-trimethylbenzenesulfonate (PubChem CID 10648416) has the molecular formula C24H32O6S2 and a molecular weight of 480.65 g/mol. Its IUPAC name is [(1R,2R)-2-[(2,4,6-trimethylphenyl)sulfonyloxymethyl]cyclobutyl]methyl 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(1R,2R)-2-[(2,4,6-trimethylphenyl)sulfonyloxymethyl]cyclobutyl]methyl 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 10648416 |
| Molecular Formula | C24H32O6S2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [(1R,2R)-2-[(2,4,6-trimethylphenyl)sulfonyloxymethyl]cyclobutyl]methyl 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)OC[C@@H]2CC[C@H]2COS(=O)(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H32O6S2/c1-15-9-17(3)23(18(4)10-15)31(25,26)29-13-21-7-8-22(21)14-30-32(27,28)24-19(5)11-16(2)12-20(24)6/h9-12,21-22H,7-8,13-14H2,1-6H3/t21-,22-/m0/s1 |
| InChIKey | PVKJYVFDAOEMFU-VXKWHMMOSA-N |
| XLogP | 4.67 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|