C13H15NO2 — CID 106486019
1-[3-(furan-3-ylmethoxy)phenyl]-N-methylmethanamine (PubChem CID 106486019) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-[3-(furan-3-ylmethoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3-(furan-3-ylmethoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 106486019 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-[3-(furan-3-ylmethoxy)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cccc(OCc2ccoc2)c1 |
| InChI | InChI=1S/C13H15NO2/c1-14-8-11-3-2-4-13(7-11)16-10-12-5-6-15-9-12/h2-7,9,14H,8,10H2,1H3 |
| InChIKey | CPLIUCSAILSWNO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |