C27H38O6Si — CID 10648651
(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(3-hydroxypropyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 10648651) has the molecular formula C27H38O6Si and a molecular weight of 486.68 g/mol. Its IUPAC name is (3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(3-hydroxypropyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(3-hydroxypropyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 10648651 |
| Molecular Formula | C27H38O6Si |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(3-hydroxypropyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@](O)(CCCO)[C@@H]2O1 |
| InChI | InChI=1S/C27H38O6Si/c1-25(2,3)34(20-13-8-6-9-14-20,21-15-10-7-11-16-21)30-19-22-27(29,17-12-18-28)23-24(31-22)33-26(4,5)32-23/h6-11,13-16,22-24,28-29H,12,17-19H2,1-5H3/t22-,23-,24+,27+/m1/s1 |
| InChIKey | LUZYAANOZUNEEJ-INADMSBESA-N |
| XLogP | 2.94 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|