methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate

C8H16FNO2 — CID 106487859

IUPACmethyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate
SMILESCOC(=O)C(C)(CN)CCCF
InChIInChI=1S/C8H16FNO2/c1-8(6-10,4-3-5-9)7(11)12-2/h3-6,10H2,1-2H3
InChIKeyWMDYSIPDKSFISK-UHFFFAOYSA-N
MW177.22 g/mol
LogP0.87
Rot. Bonds5

About methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate

methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate (PubChem CID 106487859) has the molecular formula C8H16FNO2 and a molecular weight of 177.22 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate.

Molecular Properties

Compound Namemethyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate
PubChem CID106487859
Molecular FormulaC8H16FNO2
Molecular Weight177.22 g/mol
Exact Mass177.12
IUPAC Namemethyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate
SMILESCOC(=O)C(C)(CN)CCCF
InChIInChI=1S/C8H16FNO2/c1-8(6-10,4-3-5-9)7(11)12-2/h3-6,10H2,1-2H3
InChIKeyWMDYSIPDKSFISK-UHFFFAOYSA-N
XLogP0.87
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.22
LogP ≤ 50.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate?
The IUPAC name of methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate (CID 106487859) is methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate.
What is the SMILES notation for methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate?
The canonical SMILES for methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate is COC(=O)C(C)(CN)CCCF.
What is the InChIKey of methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate?
The InChIKey is WMDYSIPDKSFISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FNO2/c1-8(6-10,4-3-5-9)7(11)12-2/h3-6,10H2,1-2H3.
What are the key properties of methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate?
methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate has a molecular weight of 177.22 g/mol, XLogP of 0.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(aminomethyl)-5-fluoro-2-methylpentanoate is sourced from PubChem (CID 106487859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).