C15H29NO4S — CID 106488353
2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-methylsulfanyl-2-propylpentanoic acid (PubChem CID 106488353) has the molecular formula C15H29NO4S and a molecular weight of 319.47 g/mol. Its IUPAC name is 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-methylsulfanyl-2-propylpentanoic acid.
| Compound Name | 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-methylsulfanyl-2-propylpentanoic acid |
|---|---|
| PubChem CID | 106488353 |
| Molecular Formula | C15H29NO4S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-methylsulfanyl-2-propylpentanoic acid |
| SMILES | CCCC(CCCSC)(CNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H29NO4S/c1-6-8-15(12(17)18,9-7-10-21-5)11-16-13(19)20-14(2,3)4/h6-11H2,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | JIZPDYJNSUKWRZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|