C16H24FNO2 — CID 106488682
ethyl 2-(aminomethyl)-2-[(5-fluoro-2-methylphenyl)methyl]-3-methylbutanoate (PubChem CID 106488682) has the molecular formula C16H24FNO2 and a molecular weight of 281.37 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-2-[(5-fluoro-2-methylphenyl)methyl]-3-methylbutanoate.
| Compound Name | ethyl 2-(aminomethyl)-2-[(5-fluoro-2-methylphenyl)methyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 106488682 |
| Molecular Formula | C16H24FNO2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | ethyl 2-(aminomethyl)-2-[(5-fluoro-2-methylphenyl)methyl]-3-methylbutanoate |
| SMILES | CCOC(=O)C(CN)(Cc1cc(F)ccc1C)C(C)C |
| InChI | InChI=1S/C16H24FNO2/c1-5-20-15(19)16(10-18,11(2)3)9-13-8-14(17)7-6-12(13)4/h6-8,11H,5,9-10,18H2,1-4H3 |
| InChIKey | ZURVXNWIBYJZCU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |