C15H23NO4 — CID 106489385
2-(aminomethyl)-4-(3-methoxypropoxy)-2-phenylbutanoic acid (PubChem CID 106489385) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(3-methoxypropoxy)-2-phenylbutanoic acid.
| Compound Name | 2-(aminomethyl)-4-(3-methoxypropoxy)-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 106489385 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(aminomethyl)-4-(3-methoxypropoxy)-2-phenylbutanoic acid |
| SMILES | COCCCOCCC(CN)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO4/c1-19-9-5-10-20-11-8-15(12-16,14(17)18)13-6-3-2-4-7-13/h2-4,6-7H,5,8-12,16H2,1H3,(H,17,18) |
| InChIKey | KETHPGIWLUSMGU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|