C27H23F6NO2 — CID 10649280
(2R,3S)-4-benzyl-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-3-phenylmorpholine (PubChem CID 10649280) has the molecular formula C27H23F6NO2 and a molecular weight of 507.47 g/mol. Its IUPAC name is (2R,3S)-4-benzyl-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-3-phenylmorpholine.
| Compound Name | (2R,3S)-4-benzyl-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-3-phenylmorpholine |
|---|---|
| PubChem CID | 10649280 |
| Molecular Formula | C27H23F6NO2 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (2R,3S)-4-benzyl-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-3-phenylmorpholine |
| SMILES | C=C(O[C@H]1OCCN(Cc2ccccc2)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H23F6NO2/c1-18(21-14-22(26(28,29)30)16-23(15-21)27(31,32)33)36-25-24(20-10-6-3-7-11-20)34(12-13-35-25)17-19-8-4-2-5-9-19/h2-11,14-16,24-25H,1,12-13,17H2/t24?,25-/m1/s1 |
| InChIKey | LMZCTAAZIDZHRO-WUBHUQEYSA-N |
| XLogP | 7.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|