C13H20N2O5S — CID 106493651
ethyl 1-methyl-5-(oxolan-2-ylmethylsulfonylmethyl)pyrazole-4-carboxylate (PubChem CID 106493651) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is ethyl 1-methyl-5-(oxolan-2-ylmethylsulfonylmethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-(oxolan-2-ylmethylsulfonylmethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 106493651 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | ethyl 1-methyl-5-(oxolan-2-ylmethylsulfonylmethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1CS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C13H20N2O5S/c1-3-19-13(16)11-7-14-15(2)12(11)9-21(17,18)8-10-5-4-6-20-10/h7,10H,3-6,8-9H2,1-2H3 |
| InChIKey | DAQCUEIMEWKILX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |