C11H6F9N3O4S3 — CID 10649387
6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)-1,3-benzothiazole-2-sulfonamide (PubChem CID 10649387) has the molecular formula C11H6F9N3O4S3 and a molecular weight of 511.37 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)-1,3-benzothiazole-2-sulfonamide.
| Compound Name | 6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)-1,3-benzothiazole-2-sulfonamide |
|---|---|
| PubChem CID | 10649387 |
| Molecular Formula | C11H6F9N3O4S3 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.94 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)-1,3-benzothiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc2ccc(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C11H6F9N3O4S3/c12-8(13,10(16,17)18)9(14,15)11(19,20)30(26,27)23-4-1-2-5-6(3-4)28-7(22-5)29(21,24)25/h1-3,23H,(H2,21,24,25) |
| InChIKey | MBHOBWXKVAOSNF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|