C23H38N2O5S2Si — CID 10649499
prop-2-enyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2R)-1-oxo-1-[(3R)-5-sulfanylidenepyrrolidin-3-yl]sulfanylpropan-2-yl]azetidin-1-yl]acetate (PubChem CID 10649499) has the molecular formula C23H38N2O5S2Si and a molecular weight of 514.79 g/mol. Its IUPAC name is prop-2-enyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2R)-1-oxo-1-[(3R)-5-sulfanylidenepyrrolidin-3-yl]sulfanylpropan-2-yl]azetidin-1-yl]acetate.
| Compound Name | prop-2-enyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2R)-1-oxo-1-[(3R)-5-sulfanylidenepyrrolidin-3-yl]sulfanylpropan-2-yl]azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 10649499 |
| Molecular Formula | C23H38N2O5S2Si |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | prop-2-enyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2R)-1-oxo-1-[(3R)-5-sulfanylidenepyrrolidin-3-yl]sulfanylpropan-2-yl]azetidin-1-yl]acetate |
| SMILES | C=CCOC(=O)CN1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H](C)C(=O)S[C@H]1CNC(=S)C1 |
| InChI | InChI=1S/C23H38N2O5S2Si/c1-9-10-29-18(26)13-25-20(14(2)22(28)32-16-11-17(31)24-12-16)19(21(25)27)15(3)30-33(7,8)23(4,5)6/h9,14-16,19-20H,1,10-13H2,2-8H3,(H,24,31)/t14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | QHJYQAWSYLMRPW-SQOWSMRPSA-N |
| XLogP | 3.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|