C14H21NO2S — CID 106495037
[2-[2-(oxolan-2-ylmethylsulfanyl)ethoxy]phenyl]methanamine (PubChem CID 106495037) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is [2-[2-(oxolan-2-ylmethylsulfanyl)ethoxy]phenyl]methanamine.
| Compound Name | [2-[2-(oxolan-2-ylmethylsulfanyl)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 106495037 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [2-[2-(oxolan-2-ylmethylsulfanyl)ethoxy]phenyl]methanamine |
| SMILES | NCc1ccccc1OCCSCC1CCCO1 |
| InChI | InChI=1S/C14H21NO2S/c15-10-12-4-1-2-6-14(12)17-8-9-18-11-13-5-3-7-16-13/h1-2,4,6,13H,3,5,7-11,15H2 |
| InChIKey | PCYFBEVYYHTMFY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|