C12H23NO3S — CID 106495532
2-methyl-2-(methylamino)-4-(oxolan-2-ylmethylsulfanyl)pentanoic acid (PubChem CID 106495532) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-4-(oxolan-2-ylmethylsulfanyl)pentanoic acid.
| Compound Name | 2-methyl-2-(methylamino)-4-(oxolan-2-ylmethylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 106495532 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-methyl-2-(methylamino)-4-(oxolan-2-ylmethylsulfanyl)pentanoic acid |
| SMILES | CNC(C)(CC(C)SCC1CCCO1)C(=O)O |
| InChI | InChI=1S/C12H23NO3S/c1-9(7-12(2,13-3)11(14)15)17-8-10-5-4-6-16-10/h9-10,13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | KCQYDSDJNSGRHQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |