C26H52O6Si2 — CID 10649555
methyl (3S,6R,7S,8R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,9-dioxononanoate (PubChem CID 10649555) has the molecular formula C26H52O6Si2 and a molecular weight of 516.87 g/mol. Its IUPAC name is methyl (3S,6R,7S,8R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,9-dioxononanoate.
| Compound Name | methyl (3S,6R,7S,8R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,9-dioxononanoate |
|---|---|
| PubChem CID | 10649555 |
| Molecular Formula | C26H52O6Si2 |
| Molecular Weight | 516.87 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | methyl (3S,6R,7S,8R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,9-dioxononanoate |
| SMILES | COC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C26H52O6Si2/c1-18(17-27)22(32-34(14,15)25(6,7)8)19(2)23(29)26(9,10)20(16-21(28)30-11)31-33(12,13)24(3,4)5/h17-20,22H,16H2,1-15H3/t18-,19+,20-,22-/m0/s1 |
| InChIKey | PUYRXZPARWRARI-IIZPIQPGSA-N |
| XLogP | 6.40 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.87 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|