C28H38O9 — CID 10649578
[(1R,2R,3R,8R,9R,10R)-2,9,10-triacetyloxy-8,12,15,15-tetramethyl-13-oxo-4-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl]methyl acetate (PubChem CID 10649578) has the molecular formula C28H38O9 and a molecular weight of 518.60 g/mol. Its IUPAC name is [(1R,2R,3R,8R,9R,10R)-2,9,10-triacetyloxy-8,12,15,15-tetramethyl-13-oxo-4-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl]methyl acetate.
| Compound Name | [(1R,2R,3R,8R,9R,10R)-2,9,10-triacetyloxy-8,12,15,15-tetramethyl-13-oxo-4-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl]methyl acetate |
|---|---|
| PubChem CID | 10649578 |
| Molecular Formula | C28H38O9 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | [(1R,2R,3R,8R,9R,10R)-2,9,10-triacetyloxy-8,12,15,15-tetramethyl-13-oxo-4-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl]methyl acetate |
| SMILES | CC(=O)OCC1=CCC[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C3=C(C)C(=O)C[C@@H]([C@@H](OC(C)=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C28H38O9/c1-14-21(33)12-20-24(35-16(3)30)23-19(13-34-15(2)29)10-9-11-28(23,8)26(37-18(5)32)25(36-17(4)31)22(14)27(20,6)7/h10,20,23-26H,9,11-13H2,1-8H3/t20-,23-,24+,25+,26-,28+/m0/s1 |
| InChIKey | YEJQKYXEIWAEIU-LCJBOODFSA-N |
| XLogP | 3.63 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|