C13H22F3NO3 — CID 106499398
ethyl 4-hydroxy-4-[(3,3,3-trifluoropropylamino)methyl]cyclohexane-1-carboxylate (PubChem CID 106499398) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-[(3,3,3-trifluoropropylamino)methyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-[(3,3,3-trifluoropropylamino)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106499398 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | ethyl 4-hydroxy-4-[(3,3,3-trifluoropropylamino)methyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CNCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3NO3/c1-2-20-11(18)10-3-5-12(19,6-4-10)9-17-8-7-13(14,15)16/h10,17,19H,2-9H2,1H3 |
| InChIKey | ZLXWHUUFXACUES-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|