C13H25NO4 — CID 106499519
4-hydroxy-4-[(4-methoxybutan-2-ylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 106499519) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-hydroxy-4-[(4-methoxybutan-2-ylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-hydroxy-4-[(4-methoxybutan-2-ylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106499519 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 4-hydroxy-4-[(4-methoxybutan-2-ylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | COCCC(C)NCC1(O)CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H25NO4/c1-10(5-8-18-2)14-9-13(17)6-3-11(4-7-13)12(15)16/h10-11,14,17H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | JKWNEGVYUVWQHE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |