C31H52O5Si — CID 10649954
[(1S)-1-[(1S,3R,9S,10R,13S,14R,17S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] acetate (PubChem CID 10649954) has the molecular formula C31H52O5Si and a molecular weight of 532.84 g/mol. Its IUPAC name is [(1S)-1-[(1S,3R,9S,10R,13S,14R,17S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[(1S,3R,9S,10R,13S,14R,17S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] acetate |
|---|---|
| PubChem CID | 10649954 |
| Molecular Formula | C31H52O5Si |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | [(1S)-1-[(1S,3R,9S,10R,13S,14R,17S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] acetate |
| SMILES | COCO[C@@H]1CC2=CC=C3[C@@H]4CC[C@H]([C@H](C)OC(C)=O)[C@@]4(C)CC[C@@H]3[C@@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C31H52O5Si/c1-20(35-21(2)32)25-13-14-26-24-12-11-22-17-23(34-19-33-8)18-28(36-37(9,10)29(3,4)5)31(22,7)27(24)15-16-30(25,26)6/h11-12,20,23,25-28H,13-19H2,1-10H3/t20-,23+,25+,26-,27-,28-,30+,31-/m0/s1 |
| InChIKey | XRNRHKBFABUDBV-HVFPNMIDSA-N |
| XLogP | 7.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|