C13H22F3NO3 — CID 106499700
4-hydroxy-4-[(5,5,5-trifluoropentylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 106499700) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is 4-hydroxy-4-[(5,5,5-trifluoropentylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-hydroxy-4-[(5,5,5-trifluoropentylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106499700 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 4-hydroxy-4-[(5,5,5-trifluoropentylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(O)(CNCCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3NO3/c14-13(15,16)5-1-2-8-17-9-12(20)6-3-10(4-7-12)11(18)19/h10,17,20H,1-9H2,(H,18,19) |
| InChIKey | FCFLVACOURZNIU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|