C14H23N3O3 — CID 106499734
4-hydroxy-4-[(3-pyrazol-1-ylpropylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 106499734) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-hydroxy-4-[(3-pyrazol-1-ylpropylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-hydroxy-4-[(3-pyrazol-1-ylpropylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106499734 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-hydroxy-4-[(3-pyrazol-1-ylpropylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(O)(CNCCCn2cccn2)CC1 |
| InChI | InChI=1S/C14H23N3O3/c18-13(19)12-3-5-14(20,6-4-12)11-15-7-1-9-17-10-2-8-16-17/h2,8,10,12,15,20H,1,3-7,9,11H2,(H,18,19) |
| InChIKey | UWOXYILAIZOMOB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|