C15H20FNO3 — CID 106499820
4-[(2-fluoro-6-methylanilino)methyl]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 106499820) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[(2-fluoro-6-methylanilino)methyl]-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-fluoro-6-methylanilino)methyl]-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106499820 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-[(2-fluoro-6-methylanilino)methyl]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | Cc1cccc(F)c1NCC1(O)CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H20FNO3/c1-10-3-2-4-12(16)13(10)17-9-15(20)7-5-11(6-8-15)14(18)19/h2-4,11,17,20H,5-9H2,1H3,(H,18,19) |
| InChIKey | HKHIFQBXKWAMLL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |