C36H42N2O2 — CID 10650002
(2R,5S)-1,4-bis(2-benzhydryloxyethyl)-2,5-dimethylpiperazine (PubChem CID 10650002) has the molecular formula C36H42N2O2 and a molecular weight of 534.74 g/mol. Its IUPAC name is (2R,5S)-1,4-bis(2-benzhydryloxyethyl)-2,5-dimethylpiperazine.
| Compound Name | (2R,5S)-1,4-bis(2-benzhydryloxyethyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 10650002 |
| Molecular Formula | C36H42N2O2 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | (2R,5S)-1,4-bis(2-benzhydryloxyethyl)-2,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(CCOC(c2ccccc2)c2ccccc2)[C@@H](C)CN1CCOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H42N2O2/c1-29-27-38(24-26-40-36(33-19-11-5-12-20-33)34-21-13-6-14-22-34)30(2)28-37(29)23-25-39-35(31-15-7-3-8-16-31)32-17-9-4-10-18-32/h3-22,29-30,35-36H,23-28H2,1-2H3/t29-,30+ |
| InChIKey | LIDYDSLIYWWVDI-RNPORBBMSA-N |
| XLogP | 6.99 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |