C15H15ClN2O3 — CID 106500099
N-[2-(2-aminophenoxy)ethyl]-2-chloro-5-hydroxybenzamide (PubChem CID 106500099) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is N-[2-(2-aminophenoxy)ethyl]-2-chloro-5-hydroxybenzamide.
| Compound Name | N-[2-(2-aminophenoxy)ethyl]-2-chloro-5-hydroxybenzamide |
|---|---|
| PubChem CID | 106500099 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-[2-(2-aminophenoxy)ethyl]-2-chloro-5-hydroxybenzamide |
| SMILES | Nc1ccccc1OCCNC(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C15H15ClN2O3/c16-12-6-5-10(19)9-11(12)15(20)18-7-8-21-14-4-2-1-3-13(14)17/h1-6,9,19H,7-8,17H2,(H,18,20) |
| InChIKey | YYSSUBVJSDSGPD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|