C14H10Cl3NO2 — CID 106502134
2-chloro-N-(2,5-dichloro-4-methylphenyl)-5-hydroxybenzamide (PubChem CID 106502134) has the molecular formula C14H10Cl3NO2 and a molecular weight of 330.60 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dichloro-4-methylphenyl)-5-hydroxybenzamide.
| Compound Name | 2-chloro-N-(2,5-dichloro-4-methylphenyl)-5-hydroxybenzamide |
|---|---|
| PubChem CID | 106502134 |
| Molecular Formula | C14H10Cl3NO2 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2-chloro-N-(2,5-dichloro-4-methylphenyl)-5-hydroxybenzamide |
| SMILES | Cc1cc(Cl)c(NC(=O)c2cc(O)ccc2Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl3NO2/c1-7-4-12(17)13(6-11(7)16)18-14(20)9-5-8(19)2-3-10(9)15/h2-6,19H,1H3,(H,18,20) |
| InChIKey | CMHUAJMSSVYXQH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |