C33H31N3O5 — CID 10650300
3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-[2-(2-methylbenzoyl)anilino]propanoic acid (PubChem CID 10650300) has the molecular formula C33H31N3O5 and a molecular weight of 549.63 g/mol. Its IUPAC name is 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-[2-(2-methylbenzoyl)anilino]propanoic acid.
| Compound Name | 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-[2-(2-methylbenzoyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 10650300 |
| Molecular Formula | C33H31N3O5 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-[2-(2-methylbenzoyl)anilino]propanoic acid |
| SMILES | Cc1ccccc1C(=O)c1ccccc1NC(Cc1ccc(OCCN(C)c2nc3ccccc3o2)cc1)C(=O)O |
| InChI | InChI=1S/C33H31N3O5/c1-22-9-3-4-10-25(22)31(37)26-11-5-6-12-27(26)34-29(32(38)39)21-23-15-17-24(18-16-23)40-20-19-36(2)33-35-28-13-7-8-14-30(28)41-33/h3-18,29,34H,19-21H2,1-2H3,(H,38,39) |
| InChIKey | JKCJSSANBKMGDW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|