C13H9F9N2O6S3 — CID 10650429
2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 10650429) has the molecular formula C13H9F9N2O6S3 and a molecular weight of 556.41 g/mol. Its IUPAC name is 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 10650429 |
| Molecular Formula | C13H9F9N2O6S3 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 555.95 |
| IUPAC Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | NS(=O)(=O)c1nc2ccc(OCCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C13H9F9N2O6S3/c14-10(15,12(18,19)20)11(16,17)13(21,22)33(27,28)30-4-3-29-6-1-2-7-8(5-6)31-9(24-7)32(23,25)26/h1-2,5H,3-4H2,(H2,23,25,26) |
| InChIKey | HMUAODOJRHDKMR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|