C10H15N3O — CID 106504373
1-N-(5-methoxy-2-pyridinyl)cyclobutane-1,3-diamine (PubChem CID 106504373) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-N-(5-methoxy-2-pyridinyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(5-methoxy-2-pyridinyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 106504373 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-N-(5-methoxy-2-pyridinyl)cyclobutane-1,3-diamine |
| SMILES | COc1ccc(NC2CC(N)C2)nc1 |
| InChI | InChI=1S/C10H15N3O/c1-14-9-2-3-10(12-6-9)13-8-4-7(11)5-8/h2-3,6-8H,4-5,11H2,1H3,(H,12,13) |
| InChIKey | GUKDTXCTIGLPER-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |