C11H19N3O — CID 106504441
2-N-(5-methoxy-2-pyridinyl)-3-methylbutane-1,2-diamine (PubChem CID 106504441) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-N-(5-methoxy-2-pyridinyl)-3-methylbutane-1,2-diamine.
| Compound Name | 2-N-(5-methoxy-2-pyridinyl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 106504441 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-N-(5-methoxy-2-pyridinyl)-3-methylbutane-1,2-diamine |
| SMILES | COc1ccc(NC(CN)C(C)C)nc1 |
| InChI | InChI=1S/C11H19N3O/c1-8(2)10(6-12)14-11-5-4-9(15-3)7-13-11/h4-5,7-8,10H,6,12H2,1-3H3,(H,13,14) |
| InChIKey | AYDWWBUDQOYCOJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |