C27H26F3N3O5S — CID 10650525
7-(diethylamino)-N-[2-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)ethyl]-2-oxo-4-(trifluoromethyl)chromene-3-carboxamide (PubChem CID 10650525) has the molecular formula C27H26F3N3O5S and a molecular weight of 561.58 g/mol. Its IUPAC name is 7-(diethylamino)-N-[2-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)ethyl]-2-oxo-4-(trifluoromethyl)chromene-3-carboxamide.
| Compound Name | 7-(diethylamino)-N-[2-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)ethyl]-2-oxo-4-(trifluoromethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 10650525 |
| Molecular Formula | C27H26F3N3O5S |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 7-(diethylamino)-N-[2-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)ethyl]-2-oxo-4-(trifluoromethyl)chromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2c(C(F)(F)F)c(C(=O)NCCN3C(=O)CC(Sc4ccccc4)C3=O)c(=O)oc2c1 |
| InChI | InChI=1S/C27H26F3N3O5S/c1-3-32(4-2)16-10-11-18-19(14-16)38-26(37)22(23(18)27(28,29)30)24(35)31-12-13-33-21(34)15-20(25(33)36)39-17-8-6-5-7-9-17/h5-11,14,20H,3-4,12-13,15H2,1-2H3,(H,31,35) |
| InChIKey | KKHWIWRXUQJLQJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|