C26H24Cl4N6 — CID 10650537
N,N,N',N'-tetrakis[(4-chloro-2-pyridinyl)methyl]ethane-1,2-diamine (PubChem CID 10650537) has the molecular formula C26H24Cl4N6 and a molecular weight of 562.33 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(4-chloro-2-pyridinyl)methyl]ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis[(4-chloro-2-pyridinyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 10650537 |
| Molecular Formula | C26H24Cl4N6 |
| Molecular Weight | 562.33 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | N,N,N',N'-tetrakis[(4-chloro-2-pyridinyl)methyl]ethane-1,2-diamine |
| SMILES | Clc1ccnc(CN(CCN(Cc2cc(Cl)ccn2)Cc2cc(Cl)ccn2)Cc2cc(Cl)ccn2)c1 |
| InChI | InChI=1S/C26H24Cl4N6/c27-19-1-5-31-23(11-19)15-35(16-24-12-20(28)2-6-32-24)9-10-36(17-25-13-21(29)3-7-33-25)18-26-14-22(30)4-8-34-26/h1-8,11-14H,9-10,15-18H2 |
| InChIKey | NJBTXDJRUXQUKI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.33 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |