C17H19ClFNO — CID 106506065
2-(aminomethyl)-3-(2-chloro-6-fluorophenyl)-2-(2-methylphenyl)propan-1-ol (PubChem CID 106506065) has the molecular formula C17H19ClFNO and a molecular weight of 307.80 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(2-chloro-6-fluorophenyl)-2-(2-methylphenyl)propan-1-ol.
| Compound Name | 2-(aminomethyl)-3-(2-chloro-6-fluorophenyl)-2-(2-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 106506065 |
| Molecular Formula | C17H19ClFNO |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-(aminomethyl)-3-(2-chloro-6-fluorophenyl)-2-(2-methylphenyl)propan-1-ol |
| SMILES | Cc1ccccc1C(CN)(CO)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H19ClFNO/c1-12-5-2-3-6-14(12)17(10-20,11-21)9-13-15(18)7-4-8-16(13)19/h2-8,21H,9-11,20H2,1H3 |
| InChIKey | NWOGLBZFLVZVMX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |