C31H46O6SSi — CID 10650795
(E,2R,7R)-3-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,6-dimethylnon-5-en-4-one (PubChem CID 10650795) has the molecular formula C31H46O6SSi and a molecular weight of 574.86 g/mol. Its IUPAC name is (E,2R,7R)-3-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,6-dimethylnon-5-en-4-one.
| Compound Name | (E,2R,7R)-3-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,6-dimethylnon-5-en-4-one |
|---|---|
| PubChem CID | 10650795 |
| Molecular Formula | C31H46O6SSi |
| Molecular Weight | 574.86 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (E,2R,7R)-3-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,6-dimethylnon-5-en-4-one |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C(=O)C([C@H](C)COCc1ccc(OC)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H46O6SSi/c1-10-29(37-39(8,9)31(4,5)6)23(2)20-28(32)30(38(33,34)27-14-12-11-13-15-27)24(3)21-36-22-25-16-18-26(35-7)19-17-25/h11-20,24,29-30H,10,21-22H2,1-9H3/b23-20+/t24-,29-,30?/m1/s1 |
| InChIKey | ZXFPKSCMPFBHLY-MPDPLNEJSA-N |
| XLogP | 7.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.86 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|