C36H39BO6 — CID 10650852
(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-2-[(1R,2S)-2-(methoxymethoxymethyl)cyclopropyl]-1,3,2-dioxaborolane (PubChem CID 10650852) has the molecular formula C36H39BO6 and a molecular weight of 578.51 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-2-[(1R,2S)-2-(methoxymethoxymethyl)cyclopropyl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-2-[(1R,2S)-2-(methoxymethoxymethyl)cyclopropyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10650852 |
| Molecular Formula | C36H39BO6 |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | (4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-2-[(1R,2S)-2-(methoxymethoxymethyl)cyclopropyl]-1,3,2-dioxaborolane |
| SMILES | COCOC[C@H]1C[C@H]1B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C36H39BO6/c1-38-26-41-25-27-24-32(27)37-42-33(35(39-2,28-16-8-4-9-17-28)29-18-10-5-11-19-29)34(43-37)36(40-3,30-20-12-6-13-21-30)31-22-14-7-15-23-31/h4-23,27,32-34H,24-26H2,1-3H3/t27-,32-,33-,34-/m1/s1 |
| InChIKey | BZFQUVJTVJAVQZ-NGFCIIBRSA-N |
| XLogP | 6.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|