C34H45NO5S — CID 10650882
2-[7-(3,4-dimethoxyphenyl)-7-(4-methylphenyl)sulfanylheptyl]-6,7,8-trimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 10650882) has the molecular formula C34H45NO5S and a molecular weight of 579.80 g/mol. Its IUPAC name is 2-[7-(3,4-dimethoxyphenyl)-7-(4-methylphenyl)sulfanylheptyl]-6,7,8-trimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[7-(3,4-dimethoxyphenyl)-7-(4-methylphenyl)sulfanylheptyl]-6,7,8-trimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 10650882 |
| Molecular Formula | C34H45NO5S |
| Molecular Weight | 579.80 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 2-[7-(3,4-dimethoxyphenyl)-7-(4-methylphenyl)sulfanylheptyl]-6,7,8-trimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(C(CCCCCCN2CCc3cc(OC)c(OC)c(OC)c3C2)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C34H45NO5S/c1-24-12-15-27(16-13-24)41-32(26-14-17-29(36-2)30(22-26)37-3)11-9-7-8-10-19-35-20-18-25-21-31(38-4)34(40-6)33(39-5)28(25)23-35/h12-17,21-22,32H,7-11,18-20,23H2,1-6H3 |
| InChIKey | KLIWAWKHWKQIAF-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.80 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|