C30H38N4O8 — CID 10650919
(2S)-2-[[(2S)-2-[[(2S)-2-[[2-(4-benzamidophenyl)acetyl]amino]-4-methylpentanoyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid (PubChem CID 10650919) has the molecular formula C30H38N4O8 and a molecular weight of 582.65 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[2-(4-benzamidophenyl)acetyl]amino]-4-methylpentanoyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[2-(4-benzamidophenyl)acetyl]amino]-4-methylpentanoyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10650919 |
| Molecular Formula | C30H38N4O8 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[2-(4-benzamidophenyl)acetyl]amino]-4-methylpentanoyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)Cc1ccc(NC(=O)c2ccccc2)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C30H38N4O8/c1-17(2)14-22(28(39)33-23(16-25(36)37)29(40)34-26(18(3)4)30(41)42)32-24(35)15-19-10-12-21(13-11-19)31-27(38)20-8-6-5-7-9-20/h5-13,17-18,22-23,26H,14-16H2,1-4H3,(H,31,38)(H,32,35)(H,33,39)(H,34,40)(H,36,37)(H,41,42)/t22-,23-,26-/m0/s1 |
| InChIKey | IHNPFECGPDEUPE-FXSPECFOSA-N |
| XLogP | 2.20 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |