About CID 10650985
CID 10650985 (PubChem CID 10650985) has the molecular formula C39H30FeO2+2
and a molecular weight of 586.51 g/mol.
Molecular Properties
| Compound Name | CID 10650985 |
| PubChem CID | 10650985 |
| Molecular Formula | C39H30FeO2+2 |
| Molecular Weight | 586.51 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | — |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H]([C]2[CH][CH][CH][CH]2)[C@]2(c3ccccc3)O[C@@]1(c1ccccc1)c1ccccc12.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C34H25O2.C5H5.Fe/c35-32(25-16-4-1-5-17-25)31-30(24-14-10-11-15-24)33(26-18-6-2-7-19-26)28-22-12-13-23-29(28)34(31,36-33)27-20-8-3-9-21-27;1-2-4-5-3-1;/h1-23,30-31H;1-5H;/q;;+2/t30-,31+,33-,34+;;/m1../s1 |
| InChIKey | SRIWBYMJNOJZOO-GWGYQOQZSA-N |
| XLogP | 7.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.51 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10650985 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10650985?
The IUPAC name of CID 10650985 (CID 10650985) is not available.
What is the SMILES notation for CID 10650985?
The canonical SMILES for CID 10650985 is O=C(c1ccccc1)[C@@H]1[C@@H]([C]2[CH][CH][CH][CH]2)[C@]2(c3ccccc3)O[C@@]1(c1ccccc1)c1ccccc12.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10650985?
The InChIKey is SRIWBYMJNOJZOO-GWGYQOQZSA-N. The full InChI is InChI=1S/C34H25O2.C5H5.Fe/c35-32(25-16-4-1-5-17-25)31-30(24-14-10-11-15-24)33(26-18-6-2-7-19-26)28-22-12-13-23-29(28)34(31,36-33)27-20-8-3-9-21-27;1-2-4-5-3-1;/h1-23,30-31H;1-5H;/q;;+2/t30-,31+,33-,34+;;/m1../s1.
What are the key properties of CID 10650985?
CID 10650985 has a molecular weight of 586.51 g/mol, XLogP of 7.76, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10650985 is sourced from PubChem (CID 10650985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).