About N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide
N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide (PubChem CID 106511105) has the molecular formula C11H11BrN2O
and a molecular weight of 267.13 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide.
Molecular Properties
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide |
| PubChem CID | 106511105 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide |
| SMILES | Cc1cc(NC(=O)CC#N)cc(C)c1Br |
| InChI | InChI=1S/C11H11BrN2O/c1-7-5-9(6-8(2)11(7)12)14-10(15)3-4-13/h5-6H,3H2,1-2H3,(H,14,15) |
| InChIKey | BQMBILATZVSPKD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide?
The IUPAC name of N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide (CID 106511105) is N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide.
What is the SMILES notation for N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide?
The canonical SMILES for N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide is Cc1cc(NC(=O)CC#N)cc(C)c1Br.
What is the InChIKey of N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide?
The InChIKey is BQMBILATZVSPKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2O/c1-7-5-9(6-8(2)11(7)12)14-10(15)3-4-13/h5-6H,3H2,1-2H3,(H,14,15).
What are the key properties of N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide?
N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide has a molecular weight of 267.13 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-3,5-dimethylphenyl)-2-cyanoacetamide is sourced from PubChem (CID 106511105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).