About 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide
4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide (PubChem CID 106512272) has the molecular formula C10H15F2N3O2S
and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide |
| PubChem CID | 106512272 |
| Molecular Formula | C10H15F2N3O2S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1nnsc1C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C10H15F2N3O2S/c1-9(2,3)7-6(18-15-14-7)8(17)13-4-10(11,12)5-16/h16H,4-5H2,1-3H3,(H,13,17) |
| InChIKey | MGVOJCSZCBIIBI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide?
The IUPAC name of 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide (CID 106512272) is 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide.
What is the SMILES notation for 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide?
The canonical SMILES for 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide is CC(C)(C)c1nnsc1C(=O)NCC(F)(F)CO.
What is the InChIKey of 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide?
The InChIKey is MGVOJCSZCBIIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2N3O2S/c1-9(2,3)7-6(18-15-14-7)8(17)13-4-10(11,12)5-16/h16H,4-5H2,1-3H3,(H,13,17).
What are the key properties of 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide?
4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide has a molecular weight of 279.31 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiadiazole-5-carboxamide is sourced from PubChem (CID 106512272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).