C32H28F2N4O2S2 — CID 10651259
4-(4-fluorophenyl)-1-[2-[2-[4-(4-fluorophenyl)-5-(5-methylfuran-2-yl)imidazol-1-yl]ethyldisulfanyl]ethyl]-5-(5-methylfuran-2-yl)imidazole (PubChem CID 10651259) has the molecular formula C32H28F2N4O2S2 and a molecular weight of 602.73 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[2-[2-[4-(4-fluorophenyl)-5-(5-methylfuran-2-yl)imidazol-1-yl]ethyldisulfanyl]ethyl]-5-(5-methylfuran-2-yl)imidazole.
| Compound Name | 4-(4-fluorophenyl)-1-[2-[2-[4-(4-fluorophenyl)-5-(5-methylfuran-2-yl)imidazol-1-yl]ethyldisulfanyl]ethyl]-5-(5-methylfuran-2-yl)imidazole |
|---|---|
| PubChem CID | 10651259 |
| Molecular Formula | C32H28F2N4O2S2 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[2-[2-[4-(4-fluorophenyl)-5-(5-methylfuran-2-yl)imidazol-1-yl]ethyldisulfanyl]ethyl]-5-(5-methylfuran-2-yl)imidazole |
| SMILES | Cc1ccc(-c2c(-c3ccc(F)cc3)ncn2CCSSCCn2cnc(-c3ccc(F)cc3)c2-c2ccc(C)o2)o1 |
| InChI | InChI=1S/C32H28F2N4O2S2/c1-21-3-13-27(39-21)31-29(23-5-9-25(33)10-6-23)35-19-37(31)15-17-41-42-18-16-38-20-36-30(24-7-11-26(34)12-8-24)32(38)28-14-4-22(2)40-28/h3-14,19-20H,15-18H2,1-2H3 |
| InChIKey | QRRMNNSOEVHRPV-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|