C7H14F3NO2S — CID 106513185
2,2,2-trifluoro-N-(2-propan-2-ylsulfonylethyl)ethanamine (PubChem CID 106513185) has the molecular formula C7H14F3NO2S and a molecular weight of 233.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-propan-2-ylsulfonylethyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-N-(2-propan-2-ylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 106513185 |
| Molecular Formula | C7H14F3NO2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-propan-2-ylsulfonylethyl)ethanamine |
| SMILES | CC(C)S(=O)(=O)CCNCC(F)(F)F |
| InChI | InChI=1S/C7H14F3NO2S/c1-6(2)14(12,13)4-3-11-5-7(8,9)10/h6,11H,3-5H2,1-2H3 |
| InChIKey | SDDGRMDVFHVYGN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|