C36H52O6Si — CID 10651352
(2S,6S,8S)-2,8-bis(2-phenylmethoxyethyl)-4-tri(propan-2-yl)silyloxy-1,7-dioxaspiro[5.5]undec-4-en-10-one (PubChem CID 10651352) has the molecular formula C36H52O6Si and a molecular weight of 608.89 g/mol. Its IUPAC name is (2S,6S,8S)-2,8-bis(2-phenylmethoxyethyl)-4-tri(propan-2-yl)silyloxy-1,7-dioxaspiro[5.5]undec-4-en-10-one.
| Compound Name | (2S,6S,8S)-2,8-bis(2-phenylmethoxyethyl)-4-tri(propan-2-yl)silyloxy-1,7-dioxaspiro[5.5]undec-4-en-10-one |
|---|---|
| PubChem CID | 10651352 |
| Molecular Formula | C36H52O6Si |
| Molecular Weight | 608.89 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | (2S,6S,8S)-2,8-bis(2-phenylmethoxyethyl)-4-tri(propan-2-yl)silyloxy-1,7-dioxaspiro[5.5]undec-4-en-10-one |
| SMILES | CC(C)[Si](OC1=C[C@@]2(CC(=O)C[C@H](CCOCc3ccccc3)O2)O[C@@H](CCOCc2ccccc2)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H52O6Si/c1-27(2)43(28(3)4,29(5)6)42-35-22-34(18-20-39-26-31-15-11-8-12-16-31)41-36(24-35)23-32(37)21-33(40-36)17-19-38-25-30-13-9-7-10-14-30/h7-16,24,27-29,33-34H,17-23,25-26H2,1-6H3/t33-,34-,36+/m0/s1 |
| InChIKey | CPQCZBLINQCBDD-IXQHYERASA-N |
| XLogP | 8.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.89 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|