C31H42N6O7 — CID 10651376
2-[(3R,6R,9S,12R,15S)-9-[(2S)-butan-2-yl]-6-(1H-indol-3-ylmethyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetic acid (PubChem CID 10651376) has the molecular formula C31H42N6O7 and a molecular weight of 610.71 g/mol. Its IUPAC name is 2-[(3R,6R,9S,12R,15S)-9-[(2S)-butan-2-yl]-6-(1H-indol-3-ylmethyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetic acid.
| Compound Name | 2-[(3R,6R,9S,12R,15S)-9-[(2S)-butan-2-yl]-6-(1H-indol-3-ylmethyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetic acid |
|---|---|
| PubChem CID | 10651376 |
| Molecular Formula | C31H42N6O7 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 2-[(3R,6R,9S,12R,15S)-9-[(2S)-butan-2-yl]-6-(1H-indol-3-ylmethyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetic acid |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C31H42N6O7/c1-5-17(4)26-30(43)33-21(13-18-15-32-20-10-7-6-9-19(18)20)27(40)34-22(14-24(38)39)31(44)37-12-8-11-23(37)28(41)35-25(16(2)3)29(42)36-26/h6-7,9-10,15-17,21-23,25-26,32H,5,8,11-14H2,1-4H3,(H,33,43)(H,34,40)(H,35,41)(H,36,42)(H,38,39)/t17-,21+,22+,23-,25+,26-/m0/s1 |
| InChIKey | HLEWFTJDBGBVDV-HSOMYBKHSA-N |
| XLogP | 0.83 |
| TPSA | 189.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |