C38H60O6 — CID 10651415
[(4aS,9S,10S,10aS)-8,10-dihydroxy-1,1,4a-trimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-yl] (Z)-octadec-9-enoate (PubChem CID 10651415) has the molecular formula C38H60O6 and a molecular weight of 612.89 g/mol. Its IUPAC name is [(4aS,9S,10S,10aS)-8,10-dihydroxy-1,1,4a-trimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-yl] (Z)-octadec-9-enoate.
| Compound Name | [(4aS,9S,10S,10aS)-8,10-dihydroxy-1,1,4a-trimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 10651415 |
| Molecular Formula | C38H60O6 |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | [(4aS,9S,10S,10aS)-8,10-dihydroxy-1,1,4a-trimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@H]1C2=C(C(=O)C(=O)C(C(C)C)=C2O)[C@@]2(C)CCCC(C)(C)[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C38H60O6/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-27(39)44-35-29-30(33(42)32(41)28(26(2)3)31(29)40)38(6)25-22-24-37(4,5)36(38)34(35)43/h14-15,26,34-36,40,43H,7-13,16-25H2,1-6H3/b15-14-/t34-,35+,36+,38-/m1/s1 |
| InChIKey | SOLFAKOYTIIDLN-IILWFNPKSA-N |
| XLogP | 9.06 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|