About 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione
2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione (PubChem CID 106515648) has the molecular formula C13H11F3N2S
and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione |
| PubChem CID | 106515648 |
| Molecular Formula | C13H11F3N2S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)c(C)c(-c2cc(F)c(F)c(F)c2)[nH]1 |
| InChI | InChI=1S/C13H11F3N2S/c1-3-10-17-12(6(2)13(19)18-10)7-4-8(14)11(16)9(15)5-7/h4-5H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | IHDHIKPUJREVPM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione?
The IUPAC name of 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione (CID 106515648) is 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione.
What is the SMILES notation for 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione?
The canonical SMILES for 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione is CCc1nc(=S)c(C)c(-c2cc(F)c(F)c(F)c2)[nH]1.
What is the InChIKey of 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione?
The InChIKey is IHDHIKPUJREVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2S/c1-3-10-17-12(6(2)13(19)18-10)7-4-8(14)11(16)9(15)5-7/h4-5H,3H2,1-2H3,(H,17,18,19).
What are the key properties of 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione?
2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione has a molecular weight of 284.31 g/mol, XLogP of 4.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-6-(3,4,5-trifluorophenyl)-1H-pyrimidine-4-thione is sourced from PubChem (CID 106515648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).